CAS 30149-93-0 appears in our catalog under these names: 3-[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%, 3-[3-(4-CHLOROPHENYL)-1,2,4-OXADIAZOL-5-YL]PROPANOIC ACID, 97%, 97%, 3-[3-(4-CHLORO-PHENYL)-[1,2,4]OXADIAZOL-5-YL]-PROPIONIC ACID, 97%, 3-(3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)propanoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 30149-93-0) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: PZAHEYNFUFWABS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | PZAHEYNFUFWABS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCC(=O)O)Cl |
Computed by PubChem (NCBI)