Products 955963-51-6

CAS 955963-51-6 is the registry number for 1-(2-Chlorophenoxymethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid (CAS 955963-51-6) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: 1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid. InChIKey: SIBGVAKNBXLWQM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClN2O3
Molecular weight252.65 g/mol
IUPAC name1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid
InChIKeySIBGVAKNBXLWQM-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OCN2C=CC(=N2)C(=O)O)Cl

Computed by PubChem (NCBI)