CAS 730949-68-5 appears in our catalog under these names: Methyl 2-(chloromethyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate, 95%, Methyl 2-(chloromethyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 0,5g.
Methyl 2-(chloromethyl)-4-oxo-3H-quinazoline-7-carboxylate (CAS 730949-68-5) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: methyl 2-(chloromethyl)-4-oxo-3H-quinazoline-7-carboxylate. InChIKey: AKOLVCTUEUWOIR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 2-(chloromethyl)-4-oxo-3H-quinazoline-7-carboxylate |
| InChIKey | AKOLVCTUEUWOIR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)NC(=N2)CCl |
Computed by PubChem (NCBI)