CAS 2247102-38-9 is the registry number for 2-(pyridin-3-yloxy)pyridine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-pyridin-3-yloxypyridine-3-carboxylic acid;hydrochloride (CAS 2247102-38-9) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: 2-pyridin-3-yloxypyridine-3-carboxylic acid;hydrochloride. InChIKey: DWVQKGJUOXTUDR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | 2-pyridin-3-yloxypyridine-3-carboxylic acid;hydrochloride |
| InChIKey | DWVQKGJUOXTUDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=C(C=CC=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)