Products 2247102-38-9

CAS 2247102-38-9 is the registry number for 2-(pyridin-3-yloxy)pyridine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-pyridin-3-yloxypyridine-3-carboxylic acid;hydrochloride (CAS 2247102-38-9) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: 2-pyridin-3-yloxypyridine-3-carboxylic acid;hydrochloride. InChIKey: DWVQKGJUOXTUDR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClN2O3
Molecular weight252.65 g/mol
IUPAC name2-pyridin-3-yloxypyridine-3-carboxylic acid;hydrochloride
InChIKeyDWVQKGJUOXTUDR-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)OC2=C(C=CC=N2)C(=O)O.Cl

Computed by PubChem (NCBI)