cas: 878437-14-0 — see every product listed under this CAS number, including other names
3-(3-(Furan-2-yl)-1,2,4-oxadiazol-5-yl)propanoic acid 95+% (CAS 878437-14-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192186-1g |
| cas | 878437-14-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 1227.00 Pln | |
| Ambeed | 10g | 1922.31 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A192186 |
3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 878437-14-0) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: GPXYVWJULSGVSI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | GPXYVWJULSGVSI-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NOC(=N2)CCC(=O)O |
Computed by PubChem (NCBI)