cas: 878437-14-0 — see every product listed under this CAS number, including other names
3-[3-(2-furyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95+%, 95+% (CAS 878437-14-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115JG1-10g |
| cas | 878437-14-0 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1672.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1067.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 878437-14-0) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: GPXYVWJULSGVSI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | GPXYVWJULSGVSI-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NOC(=N2)CCC(=O)O |
Computed by PubChem (NCBI)