CAS 85160-82-3 appears in our catalog under these names: 2-Methyl-7-nitro-2,4-dihydro-1,4-benzoxazin-3-one, 96%, 2-Methyl-7-nitro-2H-1,4-benzoxazin-3(4H)-one 98%, 2-Methyl-7-nitro-2,4-dihydro-1,4-benzoxazin-3-one, 98%, 98%, 2-METHYL-7-NITRO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 2-METHYL-7-NITRO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 97%(LC-MS),RG. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-methyl-7-nitro-4H-1,4-benzoxazin-3-one (CAS 85160-82-3) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 2-methyl-7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: KBLXGQKTRWROCS-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-methyl-7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | KBLXGQKTRWROCS-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)