CAS 57463-01-1 is the registry number for 2-Methyl-6-nitro-2,4-dihydro-1,4-benzoxazin-3-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
2-methyl-6-nitro-4H-1,4-benzoxazin-3-one (CAS 57463-01-1) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 2-methyl-6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: JIRMEYNXGZSORX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-methyl-6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | JIRMEYNXGZSORX-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)