Products 2219371-87-4
CAS 2219371-87-4 appears in our catalog under these names: 3-(3-(Trifluoromethyl)-3H-diazirin-3-yl)azetidine hydrochloride, 97%, 97%, 3-(3-(Trifluoromethyl)-3H-diazirin-3-yl)azetidine hydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
3-[3-(trifluoromethyl)diazirin-3-yl]azetidine;hydrochloride (CAS 2219371-87-4) is a chemical compound with the molecular formula C5H7ClF3N3 and a molecular weight of 201.58 g/mol. IUPAC name: 3-[3-(trifluoromethyl)diazirin-3-yl]azetidine;hydrochloride. InChIKey: DGDIINATPVFYKH-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF3N3 |
|---|---|
| Molecular weight | 201.58 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)diazirin-3-yl]azetidine;hydrochloride |
| InChIKey | DGDIINATPVFYKH-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2(N=N2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)