CAS 1431962-50-3 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1h-pyrazol-3-amine hydrochloride, 95%, 1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-amine hydrochloride, 98%, 1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-amine hydrochloride, 98%, 98%, 1-methyl-5-(trifluoromethyl)-1{H}-pyrazol-3-amine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
1-methyl-5-(trifluoromethyl)pyrazol-3-amine;hydrochloride (CAS 1431962-50-3) is a chemical compound with the molecular formula C5H7ClF3N3 and a molecular weight of 201.58 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)pyrazol-3-amine;hydrochloride. InChIKey: PBFLHANLZGUFOV-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF3N3 |
|---|---|
| Molecular weight | 201.58 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)pyrazol-3-amine;hydrochloride |
| InChIKey | PBFLHANLZGUFOV-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)