CAS 2639412-65-8 is the registry number for (1-(Trifluoromethyl)-1H-imidazol-2-yl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
[1-(trifluoromethyl)imidazol-2-yl]methanamine;hydrochloride (CAS 2639412-65-8) is a chemical compound with the molecular formula C5H7ClF3N3 and a molecular weight of 201.58 g/mol. IUPAC name: [1-(trifluoromethyl)imidazol-2-yl]methanamine;hydrochloride. InChIKey: MYDOIKINMPXFJR-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF3N3 |
|---|---|
| Molecular weight | 201.58 g/mol |
| IUPAC name | [1-(trifluoromethyl)imidazol-2-yl]methanamine;hydrochloride |
| InChIKey | MYDOIKINMPXFJR-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)