CAS 2197061-99-5 is the registry number for 1-(2,2,2-Trifluoroethyl)-1H-pyrazol-5-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2-(2,2,2-trifluoroethyl)pyrazol-3-amine;hydrochloride (CAS 2197061-99-5) is a chemical compound with the molecular formula C5H7ClF3N3 and a molecular weight of 201.58 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)pyrazol-3-amine;hydrochloride. InChIKey: PHARLTSQRFVNAG-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF3N3 |
|---|---|
| Molecular weight | 201.58 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethyl)pyrazol-3-amine;hydrochloride |
| InChIKey | PHARLTSQRFVNAG-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)