3-(3-fluorophenoxy)azetidine hydrochloride, 98%
cas: 1236861-75-8 — see every product listed under this CAS number, including other names
3-(3-fluorophenoxy)azetidine hydrochloride, 98% (CAS 1236861-75-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F360521-1G |
| cas | 1236861-75-8 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1466.17 Pln | |
| Fluorochem | 10g | 2372.10 Pln | |
| Fluorochem | 25g | 4688.99 Pln | |
| Fluorochem | 100g | 14352.26 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(3-fluorophenoxy)azetidine;hydrochloride (CAS 1236861-75-8) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: 3-(3-fluorophenoxy)azetidine;hydrochloride. InChIKey: QJEPGMVEGMNWEM-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 3-(3-fluorophenoxy)azetidine;hydrochloride |
| InChIKey | QJEPGMVEGMNWEM-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)