CAS 1266230-22-1 appears in our catalog under these names: (R)-7-Fluorochroman-4-amine hydrochloride, 95%, (R)–7–Fluorochroman–4–amine hydrochloride, (R)-7-Fluorochroman-4-amine hydrochloride, 95%, 95%, (R)-7-Fluorochroman-4-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(4R)-7-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1266230-22-1) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: (4R)-7-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: NTOXKACXYHMVON-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | (4R)-7-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | NTOXKACXYHMVON-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)