CAS 2490709-40-3 is the registry number for 5-Fluorochroman-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
5-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2490709-40-3) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: 5-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: JMSVFJMVGBTPLP-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 5-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | JMSVFJMVGBTPLP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C(=CC=C2)F.Cl |
Computed by PubChem (NCBI)