CAS 787615-38-7 appears in our catalog under these names: 3-Amino-3-(4-chloro-3-fluorophenyl)propan-1-ol, 95%, 3-Amino-3-(4-chloro-3-fluorophenyl)propan-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-amino-3-(4-chloro-3-fluorophenyl)propan-1-ol (CAS 787615-38-7) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: 3-amino-3-(4-chloro-3-fluorophenyl)propan-1-ol. InChIKey: FEFLEQVGCBGMTC-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 3-amino-3-(4-chloro-3-fluorophenyl)propan-1-ol |
| InChIKey | FEFLEQVGCBGMTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CCO)N)F)Cl |
Computed by PubChem (NCBI)