cas: 1187055-81-7 — see every product listed under this CAS number, including other names
3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CYCLOHEX-2-ENONE, 95% (CAS 1187055-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333157-100MG |
| cas | 1187055-81-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 841.39 Pln | |
| Fluorochem | 25g | 1684.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one (CAS 1187055-81-7) is a chemical compound with the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one. InChIKey: GFYZIQQOKLUEAW-UHFFFAOYSA-N.
| Molecular formula | C12H19BO3 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one |
| InChIKey | GFYZIQQOKLUEAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=O)CCC2 |
Computed by PubChem (NCBI)