CAS 1073338-90-5 is the registry number for 4,5–Dimethylfuran–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-(4,5-dimethylfuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073338-90-5) is a chemical compound with the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. IUPAC name: 2-(4,5-dimethylfuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QRDSPWHVPCTWNF-UHFFFAOYSA-N.
| Molecular formula | C12H19BO3 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 2-(4,5-dimethylfuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QRDSPWHVPCTWNF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(O2)C)C |
Computed by PubChem (NCBI)