Products 121219-08-7
CAS 121219-08-7 appears in our catalog under these names: 4-Hexyloxyphenylboronic acid, 95-<97%, 4-Hexyloxyphenylboronic acid, ≥97-<99%, 4–Hexyloxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Hexyloxyphenylboronic Acid (contains varying amounts of Anhydride), B-[4-(Hexyloxy)phenyl]boronic acid 98%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g, 25g, 5g.
(4-hexoxyphenyl)boronic acid (CAS 121219-08-7) is a chemical compound with the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. IUPAC name: (4-hexoxyphenyl)boronic acid. InChIKey: XYNVLFGOOWUKQS-UHFFFAOYSA-N.
| Molecular formula | C12H19BO3 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | (4-hexoxyphenyl)boronic acid |
| InChIKey | XYNVLFGOOWUKQS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Hexyloxyphenylboronic acid, B-[4-(Hexyloxy)phenyl]boronic acid, B-(4-(Hexyloxy)phenyl)boronic acid, (4-hexoxyphenyl)boronic Acid, 4-(n-Hexyloxy)benzeneboronic acid, 4-(hexyloxy)phenylboronic acid, 4-Hexyloxybenzeneboronic Acid, (4-(hexyloxy)phenyl)boronic acid, [4-(hexyloxy)phenyl]boronic acid, 4-Hexyloxyphenylboronic Acid (contains varying amounts of Anhydride)