cas: 937366-55-7 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 95%, 95% (CAS 937366-55-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H294-50mg |
| cas | 937366-55-7 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 640.40 Pln | |
| Chemat | 100mg | 942.80 Pln | |
| Chemat | 250mg | 1893.20 Pln | |
| Chemat | 1g | 5008.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole (CAS 937366-55-7) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole. InChIKey: UWAAHKNOJPKHNF-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole |
| InChIKey | UWAAHKNOJPKHNF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=CC3=NN2 |
Computed by PubChem (NCBI)