Products 1352227-38-3
CAS 1352227-38-3 appears in our catalog under these names: 6-Azaindole-4-boronic acid pinacol ester, 95%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo(2,3-c)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-c]pyridine (CAS 1352227-38-3) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-c]pyridine. InChIKey: PHCGSGGLCPMTHA-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-c]pyridine |
| InChIKey | PHCGSGGLCPMTHA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC3=C2C=CN3 |
Computed by PubChem (NCBI)