CAS 754214-56-7 appears in our catalog under these names: 7–Azaindole–5–boronic acid pinacol ester, Pyrrolo[2,3-b]pyridine-5-boronic acid, pinacol ester, 97%, 7-Azaindole-5-boronic acid pinacol ester, 97% , 7-Azaindole-5-boronic acid pinacol ester, 97%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97%. Offered by: GLPBio, Combi-blocks, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Chemat. Available pack sizes: 1g, 10g, 100g, 5g, 25g, 250mg, 100mg, 15g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (CAS 754214-56-7) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: UOXAMYZTYZLSCC-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | UOXAMYZTYZLSCC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NC=C3)N=C2 |
Computed by PubChem (NCBI)