CAS 915411-02-8 appears in our catalog under these names: Indazole-7-boronic acid, pinacol ester, 95%, 1H-Indazole-7-boronic acid pinacol ester, 97%, 97%, 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%, (1H-INDAZOL-7-YL)BORONIC ACID PINACOL ESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg, 50g.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 915411-02-8) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: KZRYMNAPWVDMDN-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | KZRYMNAPWVDMDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=NN3 |
Computed by PubChem (NCBI)