cas: 188665-74-9 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%, 98% (CAS 188665-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113H4J-100mg |
| cas | 188665-74-9 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 462.80 Pln | |
| Chemat | 25g | 746.00 Pln | |
| Chemat | 100g | 2594.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 188665-74-9) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BPKIPHYWHVOWMS-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BPKIPHYWHVOWMS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N |
Computed by PubChem (NCBI)