Products 480425-37-4

CAS 480425-37-4 is the registry number for 3-Formamidophenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide (CAS 480425-37-4) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide. InChIKey: NYDQNRBQQQKVKY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18BNO3
Molecular weight247.10 g/mol
IUPAC nameN-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide
InChIKeyNYDQNRBQQQKVKY-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC=O

Computed by PubChem (NCBI)