CAS 480425-37-4 is the registry number for 3-Formamidophenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide (CAS 480425-37-4) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide. InChIKey: NYDQNRBQQQKVKY-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide |
| InChIKey | NYDQNRBQQQKVKY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC=O |
Computed by PubChem (NCBI)