cas: 6272-45-3 — see every product listed under this CAS number, including other names
3-(4-(Benzyloxy)phenyl)acrylic acid, 98%, 98% (CAS 6272-45-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAB2-250mg |
| cas | 6272-45-3 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (CAS 6272-45-3) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: HCMSDYVKYZIYGA-DHZHZOJOSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | HCMSDYVKYZIYGA-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)