Products 227105-11-5
CAS 227105-11-5 appears in our catalog under these names: Compound 227105-11-5, (E)-3-(4-(Benzyloxy)phenyl)acrylic acid, 99%, 99%, 3-[4-(PhenylMethoxy)phenyl]-2-Propenoic acid, 99%. Offered by: TargetMol, Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 500mg, 1g, 5g, 10g, 25g, 100g.
(E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (CAS 227105-11-5) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: HCMSDYVKYZIYGA-DHZHZOJOSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | HCMSDYVKYZIYGA-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-[4-(benzyloxy)phenyl]prop-2-enoic acid, 3-(4-Benzyloxy-phenyl)-acrylic acid, (2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid, (E)-3-(4-(Benzyloxy)phenyl)acrylic acid, 3-[4-(benzyloxy)phenyl]acrylic acid, 3-(4-(Benzyloxy)phenyl)acrylic acid, 3-[4-(Benzyloxy)phenyl]prop-2-enoic acid, (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid, 3-[4-(phenylmethoxy)phenyl]-2-propenoic acid, orb2276614