Products 256956-42-0
CAS 256956-42-0 appears in our catalog under these names: 3-[4-(Bromomethyl)phenyl]-5-methyl-1,2,4-oxadiazole, 97% , 3-[4-(bromomethyl)phenyl]-5-methyl-1,2,4-oxadiazole, 95%, 95%, 3-(4-(Bromomethyl)phenyl)-5-methyl-1,2,4-oxadiazole, 95%. Offered by: Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 250MG, 1g, 5g, 10g, 25g.
3-[4-(bromomethyl)phenyl]-5-methyl-1,2,4-oxadiazole (CAS 256956-42-0) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 3-[4-(bromomethyl)phenyl]-5-methyl-1,2,4-oxadiazole. InChIKey: BMXSEDLZMUPKSH-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 3-[4-(bromomethyl)phenyl]-5-methyl-1,2,4-oxadiazole |
| InChIKey | BMXSEDLZMUPKSH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)