3-(4-(N,N-Dimethylsulfamoyl)phenyl)acrylic acid, 95% (E)
cas: 926260-38-0 — see every product listed under this CAS number, including other names
3-(4-(N,N-Dimethylsulfamoyl)phenyl)acrylic acid, 95% (E) (CAS 926260-38-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1105734-100mg |
| cas | 926260-38-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 813.20 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 780.86 Pln |
properties
| purity | 95% (E) |
|---|---|
| delivery time | 2-3 weeks |
(E)-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enoic acid (CAS 926260-38-0) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: (E)-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enoic acid. InChIKey: BOVKAMOMPROOMA-VMPITWQZSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | (E)-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enoic acid |
| InChIKey | BOVKAMOMPROOMA-VMPITWQZSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)