Products 53324-51-9
CAS 53324-51-9 appears in our catalog under these names: 3-(1,1-Dioxido-1,2-thiazinan-2-yl)benzoic acid, 95%, 3-(1,1-Dioxido-1,2-thiazinan-2-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 500mg.
3-(1,1-dioxothiazinan-2-yl)benzoic acid (CAS 53324-51-9) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 3-(1,1-dioxothiazinan-2-yl)benzoic acid. InChIKey: BDUXZYWBMNHIMV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 3-(1,1-dioxothiazinan-2-yl)benzoic acid |
| InChIKey | BDUXZYWBMNHIMV-UHFFFAOYSA-N |
| SMILES | C1CCS(=O)(=O)N(C1)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(1,1-dioxido-1,2-thiazinan-2-yl)benzoic acid, 3-(1,1-dioxothiazinan-2-yl)benzoic acid, 3-(1,1-dioxo-1,2-thiazaperhydroin-2-yl)benzoic acid, 3-(1,1-Dioxo-[1,2]thiazinan-2-yl)-benzoic acid, 3-(1,1-dioxo-1$l^{6},2-thiazinan-2-yl)benzoic acid, 3-(1,1-dioxo-1lambda6,2-thiazinan-2-yl)benzoic acid