Products 451485-62-4

CAS 451485-62-4 is the registry number for 4-(1,1-Dioxo-1lambda(6),4-thiazinan-4-yl)benzenecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid (CAS 451485-62-4) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid. InChIKey: CEQTXJDEBJMUCN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4S
Molecular weight255.29 g/mol
IUPAC name4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid
InChIKeyCEQTXJDEBJMUCN-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCN1C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)