Products 400878-25-3

CAS 400878-25-3 is the registry number for 2-(1,1-Dioxo-1lambda(6),4-thiazinan-4-yl)benzenecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid (CAS 400878-25-3) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid. InChIKey: DZCCOELGUIUSRY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4S
Molecular weight255.29 g/mol
IUPAC name2-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid
InChIKeyDZCCOELGUIUSRY-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCN1C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)