CAS 400878-25-3 is the registry number for 2-(1,1-Dioxo-1lambda(6),4-thiazinan-4-yl)benzenecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid (CAS 400878-25-3) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid. InChIKey: DZCCOELGUIUSRY-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid |
| InChIKey | DZCCOELGUIUSRY-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)