3-(4-Bromophenyl)oxetane-3-carboxylic acid, 97%
cas: 1393585-20-0 — see every product listed under this CAS number, including other names
3-(4-Bromophenyl)oxetane-3-carboxylic acid, 97% (CAS 1393585-20-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A716924-100mg |
| cas | 1393585-20-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 598.44 Pln | |
| Ambeed | 250mg | 943.31 Pln | |
| Ambeed | 1g | 2211.56 Pln | |
| Ambeed | 5g | 8697.44 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 500mg | 1110.80 Pln | |
| Chemat | 1g | 1610.00 Pln | |
| Chemat | 5g | 6184.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-(4-bromophenyl)oxetane-3-carboxylic acid (CAS 1393585-20-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 3-(4-bromophenyl)oxetane-3-carboxylic acid. InChIKey: XHLYQWDVGGDALC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 3-(4-bromophenyl)oxetane-3-carboxylic acid |
| InChIKey | XHLYQWDVGGDALC-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)