cas: 174603-48-6 — see every product listed under this CAS number, including other names
3-(4-Chloro-2-fluorophenyl)propanoic acid, 98% (CAS 174603-48-6) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233894-500MG |
| cas | 174603-48-6 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 284.29 Pln | |
| Fluorochem | 1g | 435.28 Pln | |
| Fluorochem | 2.5g | 1002.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-chloro-2-fluorophenyl)propanoic acid (CAS 174603-48-6) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 3-(4-chloro-2-fluorophenyl)propanoic acid. InChIKey: BPNDGBIQQXCTBI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 3-(4-chloro-2-fluorophenyl)propanoic acid |
| InChIKey | BPNDGBIQQXCTBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)CCC(=O)O |
Computed by PubChem (NCBI)