CAS 131728-94-4 appears in our catalog under these names: 8-(Chloromethyl)-6-fluoro-4h-1,3-benzodioxine, 95%, 8-(Chloromethyl)-6-fluoro-4H-1,3-benzodioxine, 97% , 8-(Chloromethyl)-6-fluorobenzo-1,3-dioxan, 95%. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250MG.
8-(chloromethyl)-6-fluoro-4H-1,3-benzodioxine (CAS 131728-94-4) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 8-(chloromethyl)-6-fluoro-4H-1,3-benzodioxine. InChIKey: FMONGDHUPLQOCP-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 8-(chloromethyl)-6-fluoro-4H-1,3-benzodioxine |
| InChIKey | FMONGDHUPLQOCP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)CCl)OCO1 |
Computed by PubChem (NCBI)