Products 1823430-49-4
CAS 1823430-49-4 appears in our catalog under these names: 3-Chloro-4-ethoxy-2-fluorobenzaldehyde, 97%, 3-Chloro-4-ethoxy-2-fluoro benzaldehyde, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-chloro-4-ethoxy-2-fluorobenzaldehyde (CAS 1823430-49-4) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 3-chloro-4-ethoxy-2-fluorobenzaldehyde. InChIKey: GJGRZFNYYFHAAA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 3-chloro-4-ethoxy-2-fluorobenzaldehyde |
| InChIKey | GJGRZFNYYFHAAA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C=O)F)Cl |
Computed by PubChem (NCBI)