CAS 174603-38-4 appears in our catalog under these names: 3-(2-Chloro-4-fluorophenyl)propionic acid, 98%, 3-(2-Chloro-4-fluorophenyl)propanoic acid, 97%, 3-(2-Chloro-4-fluoro-phenyl)-propionic acid, 95%, 3-(2-Chloro-4-fluorophenyl)propanoic Acid, 98%, 98%. Offered by: Fluorochem, Ambeed, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
3-(2-chloro-4-fluorophenyl)propanoic acid (CAS 174603-38-4) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 3-(2-chloro-4-fluorophenyl)propanoic acid. InChIKey: CWLAMJYAQMNGPA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 3-(2-chloro-4-fluorophenyl)propanoic acid |
| InChIKey | CWLAMJYAQMNGPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)CCC(=O)O |
Computed by PubChem (NCBI)