cas: 689250-53-1 — see every product listed under this CAS number, including other names
3-(4-Fluoro-phenyl)-1-methyl-1H-pyrazole-4-carbaldehyde (CAS 689250-53-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059250-250MG |
| cas | 689250-53-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1450.55 Pln | |
| Fluorochem | 500mg | 2122.19 Pln |
| delivery time | 2-3 weeks |
|---|
3-(4-fluorophenyl)-1-methylpyrazole-4-carbaldehyde (CAS 689250-53-1) is a chemical compound with the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. IUPAC name: 3-(4-fluorophenyl)-1-methylpyrazole-4-carbaldehyde. InChIKey: FDGWWNFZSAQDAN-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1-methylpyrazole-4-carbaldehyde |
| InChIKey | FDGWWNFZSAQDAN-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)F)C=O |
Computed by PubChem (NCBI)