Products 339278-28-3
CAS 339278-28-3 is the registry number for (2Z)-3-(4-Fluorophenyl)-2-[(1e)-(methoxyimino)methyl]prop-2-enenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-3-(4-fluorophenyl)-2-[(E)-methoxyiminomethyl]prop-2-enenitrile (CAS 339278-28-3) is a chemical compound with the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. IUPAC name: (Z)-3-(4-fluorophenyl)-2-[(E)-methoxyiminomethyl]prop-2-enenitrile. InChIKey: UWRZDKNGWLCMTN-FGEXGLGOSA-N.
| Molecular formula | C11H9FN2O |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | (Z)-3-(4-fluorophenyl)-2-[(E)-methoxyiminomethyl]prop-2-enenitrile |
| InChIKey | UWRZDKNGWLCMTN-FGEXGLGOSA-N |
| SMILES | CO/N=C/C(=C/C1=CC=C(C=C1)F)/C#N |
Computed by PubChem (NCBI)