Products 175135-64-5
CAS 175135-64-5 appears in our catalog under these names: 3-Amino-2-(4-fluorophenoxy)pyridine, 97%, 3-Amino-2-(4-fluorophenoxy)pyridine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-(4-fluorophenoxy)pyridin-3-amine (CAS 175135-64-5) is a chemical compound with the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. IUPAC name: 2-(4-fluorophenoxy)pyridin-3-amine. InChIKey: GMDOUPKGOUGJHO-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)pyridin-3-amine |
| InChIKey | GMDOUPKGOUGJHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)