Products 1177283-25-8
CAS 1177283-25-8 is the registry number for 1-[1-(4-Fluorophenyl)-1h-pyrazol-4-yl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone (CAS 1177283-25-8) is a chemical compound with the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. IUPAC name: 1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone. InChIKey: IOEXZAGJOSNXIL-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 1-[1-(4-fluorophenyl)pyrazol-4-yl]ethanone |
| InChIKey | IOEXZAGJOSNXIL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(N=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)