3-(4-Fluorophenoxy)pyrrolidine hydrochloride, 95%
cas: 23123-11-7 — see every product listed under this CAS number, including other names
3-(4-Fluorophenoxy)pyrrolidine hydrochloride, 95% (CAS 23123-11-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A123548-250mg |
| cas | 23123-11-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 2256.06 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 467.60 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 597.59 Pln | |
| BLDpharm | 5g | 2424.73 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 2325.24 Pln | |
| Fluorochem | 10g | 4543.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(4-fluorophenoxy)pyrrolidine;hydrochloride (CAS 23123-11-7) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 3-(4-fluorophenoxy)pyrrolidine;hydrochloride. InChIKey: RRDLUHKAJWPKCW-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 3-(4-fluorophenoxy)pyrrolidine;hydrochloride |
| InChIKey | RRDLUHKAJWPKCW-UHFFFAOYSA-N |
| SMILES | C1CNCC1OC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)