CAS 1314419-67-4 appears in our catalog under these names: (R)–3–(4–Fluorophenoxy)pyrrolidine hydrochloride, (R)-3-(4-Fluorophenoxy)pyrrolidine hydrochloride 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-(4-fluorophenoxy)pyrrolidine;hydrochloride (CAS 1314419-67-4) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: (3R)-3-(4-fluorophenoxy)pyrrolidine;hydrochloride. InChIKey: RRDLUHKAJWPKCW-HNCPQSOCSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | (3R)-3-(4-fluorophenoxy)pyrrolidine;hydrochloride |
| InChIKey | RRDLUHKAJWPKCW-HNCPQSOCSA-N |
| SMILES | C1CNC[C@@H]1OC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)