CAS 2089649-27-2 is the registry number for 3-(4-Fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid (CAS 2089649-27-2) is a chemical compound with the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. IUPAC name: 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid. InChIKey: SILVEZIRZXTQNU-UHFFFAOYSA-N.
| Molecular formula | C11H9FO2 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid |
| InChIKey | SILVEZIRZXTQNU-UHFFFAOYSA-N |
| SMILES | C1C2(C1(C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)