Products 2089649-27-2

CAS 2089649-27-2 is the registry number for 3-(4-Fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid (CAS 2089649-27-2) is a chemical compound with the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. IUPAC name: 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid. InChIKey: SILVEZIRZXTQNU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FO2
Molecular weight192.19 g/mol
IUPAC name3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylic acid
InChIKeySILVEZIRZXTQNU-UHFFFAOYSA-N
SMILESC1C2(C1(C2)C(=O)O)C3=CC=C(C=C3)F

Computed by PubChem (NCBI)