CAS 528587-70-4 is the registry number for (1S,5R)-1-(3-Fluorophenyl)-3-oxabicyclo[3.1.0]hexan-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
(1S,5R)-1-(3-fluorophenyl)-3-oxabicyclo[3.1.0]hexan-2-one (CAS 528587-70-4) is a chemical compound with the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. IUPAC name: (1S,5R)-1-(3-fluorophenyl)-3-oxabicyclo[3.1.0]hexan-2-one. InChIKey: ZIGLZWUYYGXYOO-GZMMTYOYSA-N.
| Molecular formula | C11H9FO2 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | (1S,5R)-1-(3-fluorophenyl)-3-oxabicyclo[3.1.0]hexan-2-one |
| InChIKey | ZIGLZWUYYGXYOO-GZMMTYOYSA-N |
| SMILES | C1[C@@H]2[C@]1(C(=O)OC2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)