Products 1263284-56-5
CAS 1263284-56-5 appears in our catalog under these names: Ethyl 3-ethynyl-4-fluorobenzoate, 95%, Ethyl 3–ethynyl–4–fluorobenzoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 3-ethynyl-4-fluorobenzoate (CAS 1263284-56-5) is a chemical compound with the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. IUPAC name: ethyl 3-ethynyl-4-fluorobenzoate. InChIKey: DKPFCSFLUPNHIN-UHFFFAOYSA-N.
| Molecular formula | C11H9FO2 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | ethyl 3-ethynyl-4-fluorobenzoate |
| InChIKey | DKPFCSFLUPNHIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)F)C#C |
Computed by PubChem (NCBI)