CAS 445486-60-2 is the registry number for (5–(4–Fluorophenyl)–3–furyl)methanol. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
[5-(4-fluorophenyl)furan-3-yl]methanol (CAS 445486-60-2) is a chemical compound with the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. IUPAC name: [5-(4-fluorophenyl)furan-3-yl]methanol. InChIKey: HUQRTHFJFCJPKI-UHFFFAOYSA-N.
| Molecular formula | C11H9FO2 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | [5-(4-fluorophenyl)furan-3-yl]methanol |
| InChIKey | HUQRTHFJFCJPKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CO2)CO)F |
Computed by PubChem (NCBI)