cas: 96877-34-8 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)pyrrolidine oxalate, 98% (CAS 96877-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A335871-1g |
| cas | 96877-34-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7602.07 Pln | |
| AmBeed | 250mg | 3116.68 Pln | |
| AmBeed | 5g | 26559.19 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(4-methoxyphenyl)pyrrolidine;oxalic acid (CAS 96877-34-8) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: 3-(4-methoxyphenyl)pyrrolidine;oxalic acid. InChIKey: ASQXSBPARXFOEH-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)pyrrolidine;oxalic acid |
| InChIKey | ASQXSBPARXFOEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)