Products 33521-04-9

CAS 33521-04-9 is the registry number for 2,6-Dimethyl-1-oxy-pyridine-3,5-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 2,6-dimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate (CAS 33521-04-9) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: diethyl 2,6-dimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate. InChIKey: QUHNZPKYBBTNFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO5
Molecular weight267.28 g/mol
IUPAC namediethyl 2,6-dimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate
InChIKeyQUHNZPKYBBTNFQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C([N+](=C1C)[O-])C)C(=O)OCC

Computed by PubChem (NCBI)