CAS 33521-04-9 is the registry number for 2,6-Dimethyl-1-oxy-pyridine-3,5-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g.
Diethyl 2,6-dimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate (CAS 33521-04-9) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: diethyl 2,6-dimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate. InChIKey: QUHNZPKYBBTNFQ-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | diethyl 2,6-dimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate |
| InChIKey | QUHNZPKYBBTNFQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C([N+](=C1C)[O-])C)C(=O)OCC |
Computed by PubChem (NCBI)