Products 96877-34-8
CAS 96877-34-8 appears in our catalog under these names: 3-(4-Methoxyphenyl)pyrrolidine oxalate, 95%, 3-(4-Methoxyphenyl)pyrrolidine oxalate, 98%, 3–(4–Methoxyphenyl)pyrrolidine oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-(4-methoxyphenyl)pyrrolidine;oxalic acid (CAS 96877-34-8) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: 3-(4-methoxyphenyl)pyrrolidine;oxalic acid. InChIKey: ASQXSBPARXFOEH-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)pyrrolidine;oxalic acid |
| InChIKey | ASQXSBPARXFOEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)